C19H36N2O8 — CID 146349637
tert-butyl (2S)-5-hydroxy-2-[methyl-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]carbamoyl]oxypentaneperoxoate (PubChem CID 146349637) has the molecular formula C19H36N2O8 and a molecular weight of 420.50 g/mol. Its IUPAC name is tert-butyl (2S)-5-hydroxy-2-[methyl-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]carbamoyl]oxypentaneperoxoate.
| Compound Name | tert-butyl (2S)-5-hydroxy-2-[methyl-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]carbamoyl]oxypentaneperoxoate |
|---|---|
| PubChem CID | 146349637 |
| Molecular Formula | C19H36N2O8 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | tert-butyl (2S)-5-hydroxy-2-[methyl-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]carbamoyl]oxypentaneperoxoate |
| SMILES | CN(CCN(C)C(=O)OC(C)(C)C)C(=O)O[C@@H](CCCO)C(=O)OOC(C)(C)C |
| InChI | InChI=1S/C19H36N2O8/c1-18(2,3)27-17(25)21(8)12-11-20(7)16(24)26-14(10-9-13-22)15(23)28-29-19(4,5)6/h14,22H,9-13H2,1-8H3/t14-/m0/s1 |
| InChIKey | FSZHAGIYPNCPOU-AWEZNQCLSA-N |
| XLogP | 2.34 |
| TPSA | 114.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|