C12H20N2O2 — CID 54105856
tert-butyl N-(3-cyanocyclopentyl)-N-methylcarbamate (PubChem CID 54105856) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is tert-butyl N-(3-cyanocyclopentyl)-N-methylcarbamate.
| Compound Name | tert-butyl N-(3-cyanocyclopentyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 54105856 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | tert-butyl N-(3-cyanocyclopentyl)-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCC(C#N)C1 |
| InChI | InChI=1S/C12H20N2O2/c1-12(2,3)16-11(15)14(4)10-6-5-9(7-10)8-13/h9-10H,5-7H2,1-4H3 |
| InChIKey | NDSAZOLWSKMKLV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |