C14H27NO2 — CID 118422917
tert-butyl N-methyl-N-[3-(2-methylpropyl)cyclobutyl]carbamate (PubChem CID 118422917) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[3-(2-methylpropyl)cyclobutyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[3-(2-methylpropyl)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 118422917 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | tert-butyl N-methyl-N-[3-(2-methylpropyl)cyclobutyl]carbamate |
| SMILES | CC(C)CC1CC(N(C)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H27NO2/c1-10(2)7-11-8-12(9-11)15(6)13(16)17-14(3,4)5/h10-12H,7-9H2,1-6H3 |
| InChIKey | ZRBGOEWOVVNPGE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |