C18H34N2O2 — CID 107242908
tert-butyl N-[3-(1-cyclobutylpropan-2-ylamino)propyl]-N-cyclopropylcarbamate (PubChem CID 107242908) has the molecular formula C18H34N2O2 and a molecular weight of 310.48 g/mol. Its IUPAC name is tert-butyl N-[3-(1-cyclobutylpropan-2-ylamino)propyl]-N-cyclopropylcarbamate.
| Compound Name | tert-butyl N-[3-(1-cyclobutylpropan-2-ylamino)propyl]-N-cyclopropylcarbamate |
|---|---|
| PubChem CID | 107242908 |
| Molecular Formula | C18H34N2O2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.26 |
| IUPAC Name | tert-butyl N-[3-(1-cyclobutylpropan-2-ylamino)propyl]-N-cyclopropylcarbamate |
| SMILES | CC(CC1CCC1)NCCCN(C(=O)OC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C18H34N2O2/c1-14(13-15-7-5-8-15)19-11-6-12-20(16-9-10-16)17(21)22-18(2,3)4/h14-16,19H,5-13H2,1-4H3 |
| InChIKey | YWXYSIYTSTZODL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|