C18H35BN2O4 — CID 174072947
tert-butyl N-[2-[methyl-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]amino]propyl]carbamate (PubChem CID 174072947) has the molecular formula C18H35BN2O4 and a molecular weight of 354.30 g/mol. Its IUPAC name is tert-butyl N-[2-[methyl-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[methyl-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 174072947 |
| Molecular Formula | C18H35BN2O4 |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | tert-butyl N-[2-[methyl-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]amino]propyl]carbamate |
| SMILES | CC(CNC(=O)OC(C)(C)C)N(C)C/C=C/B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H35BN2O4/c1-14(13-20-15(22)23-16(2,3)4)21(9)12-10-11-19-24-17(5,6)18(7,8)25-19/h10-11,14H,12-13H2,1-9H3,(H,20,22)/b11-10+ |
| InChIKey | BLFJOQHDBNRFKS-ZHACJKMWSA-N |
| XLogP | 3.02 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|