C13H26BNO4 — CID 167729474
tert-butyl N-[(1R)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]carbamate (PubChem CID 167729474) has the molecular formula C13H26BNO4 and a molecular weight of 271.17 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 167729474 |
| Molecular Formula | C13H26BNO4 |
| Molecular Weight | 271.17 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | tert-butyl N-[(1R)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H26BNO4/c1-9(15-10(16)17-11(2,3)4)14-18-12(5,6)13(7,8)19-14/h9H,1-8H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | HEOKWLHPEVLRFL-VIFPVBQESA-N |
| XLogP | 2.53 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.17 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|