C15H29BO4 — CID 11680774
tert-butyl (4R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanoate (PubChem CID 11680774) has the molecular formula C15H29BO4 and a molecular weight of 284.20 g/mol. Its IUPAC name is tert-butyl (4R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanoate.
| Compound Name | tert-butyl (4R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanoate |
|---|---|
| PubChem CID | 11680774 |
| Molecular Formula | C15H29BO4 |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | tert-butyl (4R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanoate |
| SMILES | C[C@H](CCC(=O)OC(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H29BO4/c1-11(9-10-12(17)18-13(2,3)4)16-19-14(5,6)15(7,8)20-16/h11H,9-10H2,1-8H3/t11-/m1/s1 |
| InChIKey | LMBSFGMFQIYNMV-LLVKDONJSA-N |
| XLogP | 3.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|