C20H31BO4 — CID 102193134
tert-butyl (3S)-3-(2-methylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 102193134) has the molecular formula C20H31BO4 and a molecular weight of 346.28 g/mol. Its IUPAC name is tert-butyl (3S)-3-(2-methylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | tert-butyl (3S)-3-(2-methylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 102193134 |
| Molecular Formula | C20H31BO4 |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | tert-butyl (3S)-3-(2-methylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | Cc1ccccc1[C@H](CC(=O)OC(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H31BO4/c1-14-11-9-10-12-15(14)16(13-17(22)23-18(2,3)4)21-24-19(5,6)20(7,8)25-21/h9-12,16H,13H2,1-8H3/t16-/m0/s1 |
| InChIKey | YVSHTKYAOBEDSF-INIZCTEOSA-N |
| XLogP | 4.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|