C19H26BNO4 — CID 170816628
methyl 3-(4-methyl-1H-indol-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 170816628) has the molecular formula C19H26BNO4 and a molecular weight of 343.23 g/mol. Its IUPAC name is methyl 3-(4-methyl-1H-indol-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | methyl 3-(4-methyl-1H-indol-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 170816628 |
| Molecular Formula | C19H26BNO4 |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | methyl 3-(4-methyl-1H-indol-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | COC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1c[nH]c2cccc(C)c12 |
| InChI | InChI=1S/C19H26BNO4/c1-12-8-7-9-15-17(12)13(11-21-15)14(10-16(22)23-6)20-24-18(2,3)19(4,5)25-20/h7-9,11,14,21H,10H2,1-6H3 |
| InChIKey | KSXRQXUULSJBCU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|