C19H25BClNO4 — CID 170817212
ethyl 3-(4-chloro-1H-indol-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 170817212) has the molecular formula C19H25BClNO4 and a molecular weight of 377.68 g/mol. Its IUPAC name is ethyl 3-(4-chloro-1H-indol-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | ethyl 3-(4-chloro-1H-indol-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 170817212 |
| Molecular Formula | C19H25BClNO4 |
| Molecular Weight | 377.68 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | ethyl 3-(4-chloro-1H-indol-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | CCOC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1c[nH]c2cccc(Cl)c12 |
| InChI | InChI=1S/C19H25BClNO4/c1-6-24-16(23)10-13(20-25-18(2,3)19(4,5)26-20)12-11-22-15-9-7-8-14(21)17(12)15/h7-9,11,13,22H,6,10H2,1-5H3 |
| InChIKey | OPCDZVJCTSIJKZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.68 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|