C16H22BF2NO4 — CID 170817159
ethyl 3-(2,6-difluoro-3-pyridinyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 170817159) has the molecular formula C16H22BF2NO4 and a molecular weight of 341.16 g/mol. Its IUPAC name is ethyl 3-(2,6-difluoro-3-pyridinyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | ethyl 3-(2,6-difluoro-3-pyridinyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 170817159 |
| Molecular Formula | C16H22BF2NO4 |
| Molecular Weight | 341.16 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | ethyl 3-(2,6-difluoro-3-pyridinyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | CCOC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1ccc(F)nc1F |
| InChI | InChI=1S/C16H22BF2NO4/c1-6-22-13(21)9-11(10-7-8-12(18)20-14(10)19)17-23-15(2,3)16(4,5)24-17/h7-8,11H,6,9H2,1-5H3 |
| InChIKey | GOFYKIITCWCNLH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.16 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|