C22H33BO6 — CID 170816724
tert-butyl 4-[3-ethoxy-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]benzoate (PubChem CID 170816724) has the molecular formula C22H33BO6 and a molecular weight of 404.31 g/mol. Its IUPAC name is tert-butyl 4-[3-ethoxy-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]benzoate.
| Compound Name | tert-butyl 4-[3-ethoxy-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]benzoate |
|---|---|
| PubChem CID | 170816724 |
| Molecular Formula | C22H33BO6 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | tert-butyl 4-[3-ethoxy-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]benzoate |
| SMILES | CCOC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1ccc(C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H33BO6/c1-9-26-18(24)14-17(23-28-21(5,6)22(7,8)29-23)15-10-12-16(13-11-15)19(25)27-20(2,3)4/h10-13,17H,9,14H2,1-8H3 |
| InChIKey | GUDJCYHLZFBCDN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|