C20H31BO5 — CID 101449146
tert-butyl 3-(4-methoxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 101449146) has the molecular formula C20H31BO5 and a molecular weight of 362.28 g/mol. Its IUPAC name is tert-butyl 3-(4-methoxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | tert-butyl 3-(4-methoxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 101449146 |
| Molecular Formula | C20H31BO5 |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | tert-butyl 3-(4-methoxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | COc1ccc(C(CC(=O)OC(C)(C)C)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C20H31BO5/c1-18(2,3)24-17(22)13-16(14-9-11-15(23-8)12-10-14)21-25-19(4,5)20(6,7)26-21/h9-12,16H,13H2,1-8H3 |
| InChIKey | LFQMFQXXRXWTTR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|