C18H33BO4 — CID 134940584
tert-butyl 2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexyl]acetate (PubChem CID 134940584) has the molecular formula C18H33BO4 and a molecular weight of 324.27 g/mol. Its IUPAC name is tert-butyl 2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexyl]acetate.
| Compound Name | tert-butyl 2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexyl]acetate |
|---|---|
| PubChem CID | 134940584 |
| Molecular Formula | C18H33BO4 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | tert-butyl 2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexyl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1(B2OC(C)(C)C(C)(C)O2)CCCCC1 |
| InChI | InChI=1S/C18H33BO4/c1-15(2,3)21-14(20)13-18(11-9-8-10-12-18)19-22-16(4,5)17(6,7)23-19/h8-13H2,1-7H3 |
| InChIKey | HLUGBDFYLHWIMS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|