C16H29BO4 — CID 102026421
tert-butyl (E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-4-enoate (PubChem CID 102026421) has the molecular formula C16H29BO4 and a molecular weight of 296.22 g/mol. Its IUPAC name is tert-butyl (E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-4-enoate.
| Compound Name | tert-butyl (E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-4-enoate |
|---|---|
| PubChem CID | 102026421 |
| Molecular Formula | C16H29BO4 |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | tert-butyl (E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-4-enoate |
| SMILES | CC(C)(C)OC(=O)CC/C=C/CB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H29BO4/c1-14(2,3)19-13(18)11-9-8-10-12-17-20-15(4,5)16(6,7)21-17/h8,10H,9,11-12H2,1-7H3/b10-8+ |
| InChIKey | FZHVYZZMGOBVER-CSKARUKUSA-N |
| XLogP | 3.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|