C21H37BO6 — CID 102026418
ditert-butyl 2-[(E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]propanedioate (PubChem CID 102026418) has the molecular formula C21H37BO6 and a molecular weight of 396.33 g/mol. Its IUPAC name is ditert-butyl 2-[(E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]propanedioate.
| Compound Name | ditert-butyl 2-[(E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]propanedioate |
|---|---|
| PubChem CID | 102026418 |
| Molecular Formula | C21H37BO6 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | ditert-butyl 2-[(E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)C(C/C=C/CB1OC(C)(C)C(C)(C)O1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H37BO6/c1-18(2,3)25-16(23)15(17(24)26-19(4,5)6)13-11-12-14-22-27-20(7,8)21(9,10)28-22/h11-12,15H,13-14H2,1-10H3/b12-11+ |
| InChIKey | PGKDWMKOGMPHOZ-VAWYXSNFSA-N |
| XLogP | 4.32 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|