C30H53BO6Si — CID 101488284
methoxymethyl (2Z,4E,6S,8E,11E)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-methyl-13-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)trideca-2,4,8,11-tetraenoate (PubChem CID 101488284) has the molecular formula C30H53BO6Si and a molecular weight of 548.65 g/mol. Its IUPAC name is methoxymethyl (2Z,4E,6S,8E,11E)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-methyl-13-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)trideca-2,4,8,11-tetraenoate.
| Compound Name | methoxymethyl (2Z,4E,6S,8E,11E)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-methyl-13-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)trideca-2,4,8,11-tetraenoate |
|---|---|
| PubChem CID | 101488284 |
| Molecular Formula | C30H53BO6Si |
| Molecular Weight | 548.65 g/mol |
| Exact Mass | 548.37 |
| IUPAC Name | methoxymethyl (2Z,4E,6S,8E,11E)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-methyl-13-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)trideca-2,4,8,11-tetraenoate |
| SMILES | COCOC(=O)/C=C(\C=C\[C@@H](C)C/C=C/C/C=C/CB1OC(C)(C)C(C)(C)O1)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H53BO6Si/c1-25(17-15-13-12-14-16-21-31-36-29(5,6)30(7,8)37-31)18-19-26(23-27(32)34-24-33-9)20-22-35-38(10,11)28(2,3)4/h13-16,18-19,23,25H,12,17,20-22,24H2,1-11H3/b15-13+,16-14+,19-18+,26-23+/t25-/m0/s1 |
| InChIKey | NWAAADHJIHFMJF-BNMJKHDASA-N |
| XLogP | 7.65 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.65 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|