C18H28O3Si — CID 24800988
methyl (2Z,4E,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxyundeca-2,4,8-trien-10-ynoate (PubChem CID 24800988) has the molecular formula C18H28O3Si and a molecular weight of 320.51 g/mol. Its IUPAC name is methyl (2Z,4E,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxyundeca-2,4,8-trien-10-ynoate.
| Compound Name | methyl (2Z,4E,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxyundeca-2,4,8-trien-10-ynoate |
|---|---|
| PubChem CID | 24800988 |
| Molecular Formula | C18H28O3Si |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | methyl (2Z,4E,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxyundeca-2,4,8-trien-10-ynoate |
| SMILES | C#C/C=C/[C@H](C/C=C/C=C\C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H28O3Si/c1-8-9-13-16(21-22(6,7)18(2,3)4)14-11-10-12-15-17(19)20-5/h1,9-13,15-16H,14H2,2-7H3/b11-10+,13-9+,15-12-/t16-/m1/s1 |
| InChIKey | KTEFUBUCNCCWRK-FPFHKOOPSA-N |
| XLogP | 4.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|