C18H28O6 — CID 23557315
1-O,1-O-ditert-butyl 6-O-methyl (3E,5E)-hexa-3,5-diene-1,1,6-tricarboxylate (PubChem CID 23557315) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-O,1-O-ditert-butyl 6-O-methyl (3E,5E)-hexa-3,5-diene-1,1,6-tricarboxylate.
| Compound Name | 1-O,1-O-ditert-butyl 6-O-methyl (3E,5E)-hexa-3,5-diene-1,1,6-tricarboxylate |
|---|---|
| PubChem CID | 23557315 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 1-O,1-O-ditert-butyl 6-O-methyl (3E,5E)-hexa-3,5-diene-1,1,6-tricarboxylate |
| SMILES | COC(=O)/C=C/C=C/CC(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28O6/c1-17(2,3)23-15(20)13(16(21)24-18(4,5)6)11-9-8-10-12-14(19)22-7/h8-10,12-13H,11H2,1-7H3/b9-8+,12-10+ |
| InChIKey | WMQPEIUFHXFSDC-CDKJVOIVSA-N |
| XLogP | 2.96 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|