C21H36O3Si2 — CID 11983945
methyl (2Z,4E,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-11-trimethylsilylundeca-2,4,8-trien-10-ynoate (PubChem CID 11983945) has the molecular formula C21H36O3Si2 and a molecular weight of 392.69 g/mol. Its IUPAC name is methyl (2Z,4E,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-11-trimethylsilylundeca-2,4,8-trien-10-ynoate.
| Compound Name | methyl (2Z,4E,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-11-trimethylsilylundeca-2,4,8-trien-10-ynoate |
|---|---|
| PubChem CID | 11983945 |
| Molecular Formula | C21H36O3Si2 |
| Molecular Weight | 392.69 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | methyl (2Z,4E,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-11-trimethylsilylundeca-2,4,8-trien-10-ynoate |
| SMILES | COC(=O)/C=C\C=C\C[C@@H](/C=C/C#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O3Si2/c1-21(2,3)26(8,9)24-19(16-13-14-18-25(5,6)7)15-11-10-12-17-20(22)23-4/h10-13,16-17,19H,15H2,1-9H3/b11-10+,16-13+,17-12-/t19-/m0/s1 |
| InChIKey | DFOZCKZGBZLYCZ-OTEHWYSWSA-N |
| XLogP | 5.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.69 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|