C18H38O4Si2 — CID 102382081
methyl (E,4S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-2-enoate (PubChem CID 102382081) has the molecular formula C18H38O4Si2 and a molecular weight of 374.67 g/mol. Its IUPAC name is methyl (E,4S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-2-enoate.
| Compound Name | methyl (E,4S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-2-enoate |
|---|---|
| PubChem CID | 102382081 |
| Molecular Formula | C18H38O4Si2 |
| Molecular Weight | 374.67 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | methyl (E,4S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38O4Si2/c1-17(2,3)23(8,9)21-14-15(12-13-16(19)20-7)22-24(10,11)18(4,5)6/h12-13,15H,14H2,1-11H3/b13-12+/t15-/m0/s1 |
| InChIKey | DNNBBYACEJDMCN-LHNRBYRGSA-N |
| XLogP | 5.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.67 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|