C18H39FO4Si2 — CID 11315413
(E,5R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-fluorohex-3-ene-1,2-diol (PubChem CID 11315413) has the molecular formula C18H39FO4Si2 and a molecular weight of 394.68 g/mol. Its IUPAC name is (E,5R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-fluorohex-3-ene-1,2-diol.
| Compound Name | (E,5R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-fluorohex-3-ene-1,2-diol |
|---|---|
| PubChem CID | 11315413 |
| Molecular Formula | C18H39FO4Si2 |
| Molecular Weight | 394.68 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (E,5R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-fluorohex-3-ene-1,2-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](/C=C(/F)C(O)CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H39FO4Si2/c1-17(2,3)24(7,8)22-13-14(11-15(19)16(21)12-20)23-25(9,10)18(4,5)6/h11,14,16,20-21H,12-13H2,1-10H3/b15-11+/t14-,16?/m1/s1 |
| InChIKey | FUQDBUWTHMFVLU-KJHQTRMQSA-N |
| XLogP | 4.61 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.68 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|