C13H30O2SiSn — CID 59052911
(Z)-2-[tert-butyl(dimethyl)silyl]oxy-4-trimethylstannylbut-3-en-1-ol (PubChem CID 59052911) has the molecular formula C13H30O2SiSn and a molecular weight of 365.18 g/mol. Its IUPAC name is (Z)-2-[tert-butyl(dimethyl)silyl]oxy-4-trimethylstannylbut-3-en-1-ol.
| Compound Name | (Z)-2-[tert-butyl(dimethyl)silyl]oxy-4-trimethylstannylbut-3-en-1-ol |
|---|---|
| PubChem CID | 59052911 |
| Molecular Formula | C13H30O2SiSn |
| Molecular Weight | 365.18 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | (Z)-2-[tert-butyl(dimethyl)silyl]oxy-4-trimethylstannylbut-3-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC(/C=C\[Sn](C)(C)C)CO |
| InChI | InChI=1S/C10H21O2Si.3CH3.Sn/c1-7-9(8-11)12-13(5,6)10(2,3)4;;;;/h1,7,9,11H,8H2,2-6H3;3*1H3; |
| InChIKey | LEMJWIVBXXZSHL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.18 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|