C24H50O2S2Si2 — CID 11237195
(E,2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[2-tri(propan-2-yl)silyl-1,3-dithian-2-yl]pent-3-en-1-ol (PubChem CID 11237195) has the molecular formula C24H50O2S2Si2 and a molecular weight of 490.97 g/mol. Its IUPAC name is (E,2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[2-tri(propan-2-yl)silyl-1,3-dithian-2-yl]pent-3-en-1-ol.
| Compound Name | (E,2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[2-tri(propan-2-yl)silyl-1,3-dithian-2-yl]pent-3-en-1-ol |
|---|---|
| PubChem CID | 11237195 |
| Molecular Formula | C24H50O2S2Si2 |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | (E,2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[2-tri(propan-2-yl)silyl-1,3-dithian-2-yl]pent-3-en-1-ol |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)C1(C/C=C/[C@@H](CO)O[Si](C)(C)C(C)(C)C)SCCCS1 |
| InChI | InChI=1S/C24H50O2S2Si2/c1-19(2)30(20(3)4,21(5)6)24(27-16-13-17-28-24)15-12-14-22(18-25)26-29(10,11)23(7,8)9/h12,14,19-22,25H,13,15-18H2,1-11H3/b14-12+/t22-/m0/s1 |
| InChIKey | MOHUUIVSXNBCGI-VKXNWWILSA-N |
| XLogP | 8.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|