C15H31NOSi — CID 10445809
tert-butyl-dimethyl-[(E,2S)-5-pyrrolidin-1-ylpent-3-en-2-yl]oxysilane (PubChem CID 10445809) has the molecular formula C15H31NOSi and a molecular weight of 269.50 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,2S)-5-pyrrolidin-1-ylpent-3-en-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(E,2S)-5-pyrrolidin-1-ylpent-3-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 10445809 |
| Molecular Formula | C15H31NOSi |
| Molecular Weight | 269.50 g/mol |
| Exact Mass | 269.22 |
| IUPAC Name | tert-butyl-dimethyl-[(E,2S)-5-pyrrolidin-1-ylpent-3-en-2-yl]oxysilane |
| SMILES | C[C@@H](/C=C/CN1CCCC1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H31NOSi/c1-14(17-18(5,6)15(2,3)4)10-9-13-16-11-7-8-12-16/h9-10,14H,7-8,11-13H2,1-6H3/b10-9+/t14-/m0/s1 |
| InChIKey | UPZRITQXWZTBLY-HBWSCVEGSA-N |
| XLogP | 4.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|