C12H29NOSi2 — CID 11747325
(E,2S)-2-[tert-butyl(dimethyl)silyl]oxy-N-trimethylsilylpropan-1-imine (PubChem CID 11747325) has the molecular formula C12H29NOSi2 and a molecular weight of 259.54 g/mol. Its IUPAC name is (E,2S)-2-[tert-butyl(dimethyl)silyl]oxy-N-trimethylsilylpropan-1-imine.
| Compound Name | (E,2S)-2-[tert-butyl(dimethyl)silyl]oxy-N-trimethylsilylpropan-1-imine |
|---|---|
| PubChem CID | 11747325 |
| Molecular Formula | C12H29NOSi2 |
| Molecular Weight | 259.54 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | (E,2S)-2-[tert-butyl(dimethyl)silyl]oxy-N-trimethylsilylpropan-1-imine |
| SMILES | C[C@@H](/C=N/[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H29NOSi2/c1-11(10-13-15(5,6)7)14-16(8,9)12(2,3)4/h10-11H,1-9H3/b13-10+/t11-/m0/s1 |
| InChIKey | IHDJKGQRNZTCAN-CDDSVFCYSA-N |
| XLogP | 4.30 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|