C13H31NOSi2 — CID 11108529
(E,2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-N-trimethylsilylpropan-1-imine (PubChem CID 11108529) has the molecular formula C13H31NOSi2 and a molecular weight of 273.57 g/mol. Its IUPAC name is (E,2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-N-trimethylsilylpropan-1-imine.
| Compound Name | (E,2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-N-trimethylsilylpropan-1-imine |
|---|---|
| PubChem CID | 11108529 |
| Molecular Formula | C13H31NOSi2 |
| Molecular Weight | 273.57 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | (E,2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-N-trimethylsilylpropan-1-imine |
| SMILES | C[C@@H](/C=N/[Si](C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H31NOSi2/c1-12(10-14-16(5,6)7)11-15-17(8,9)13(2,3)4/h10,12H,11H2,1-9H3/b14-10+/t12-/m0/s1 |
| InChIKey | KBZQGVZWUMHFNL-LQELWAHVSA-N |
| XLogP | 4.55 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|