C11H27NOSi — CID 53427177
1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-amine (PubChem CID 53427177) has the molecular formula C11H27NOSi and a molecular weight of 217.43 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-amine.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 53427177 |
| Molecular Formula | C11H27NOSi |
| Molecular Weight | 217.43 g/mol |
| Exact Mass | 217.19 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-amine |
| SMILES | CC(C)C(N)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H27NOSi/c1-9(2)10(12)8-13-14(6,7)11(3,4)5/h9-10H,8,12H2,1-7H3 |
| InChIKey | WKEKXCCVQKMDFF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|