C10H26N2OSi — CID 87682388
(3S)-4-[tert-butyl(dimethyl)silyl]oxybutane-1,3-diamine (PubChem CID 87682388) has the molecular formula C10H26N2OSi and a molecular weight of 218.42 g/mol. Its IUPAC name is (3S)-4-[tert-butyl(dimethyl)silyl]oxybutane-1,3-diamine.
| Compound Name | (3S)-4-[tert-butyl(dimethyl)silyl]oxybutane-1,3-diamine |
|---|---|
| PubChem CID | 87682388 |
| Molecular Formula | C10H26N2OSi |
| Molecular Weight | 218.42 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (3S)-4-[tert-butyl(dimethyl)silyl]oxybutane-1,3-diamine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](N)CCN |
| InChI | InChI=1S/C10H26N2OSi/c1-10(2,3)14(4,5)13-8-9(12)6-7-11/h9H,6-8,11-12H2,1-5H3/t9-/m0/s1 |
| InChIKey | QXDIUIXRYOGTPP-VIFPVBQESA-N |
| XLogP | 1.68 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|