C13H29NO3Si — CID 132916594
tert-butyl (2R)-2-amino-3-[tert-butyl(dimethyl)silyl]oxypropanoate (PubChem CID 132916594) has the molecular formula C13H29NO3Si and a molecular weight of 275.47 g/mol. Its IUPAC name is tert-butyl (2R)-2-amino-3-[tert-butyl(dimethyl)silyl]oxypropanoate.
| Compound Name | tert-butyl (2R)-2-amino-3-[tert-butyl(dimethyl)silyl]oxypropanoate |
|---|---|
| PubChem CID | 132916594 |
| Molecular Formula | C13H29NO3Si |
| Molecular Weight | 275.47 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | tert-butyl (2R)-2-amino-3-[tert-butyl(dimethyl)silyl]oxypropanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](N)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H29NO3Si/c1-12(2,3)17-11(15)10(14)9-16-18(7,8)13(4,5)6/h10H,9,14H2,1-8H3/t10-/m1/s1 |
| InChIKey | USATXXGSVSROPV-SNVBAGLBSA-N |
| XLogP | 2.68 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|