C11H24NNaO3Si — CID 23697835
sodium (2R,3R)-2-amino-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbutanoate (PubChem CID 23697835) has the molecular formula C11H24NNaO3Si and a molecular weight of 269.39 g/mol. Its IUPAC name is sodium (2R,3R)-2-amino-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbutanoate.
| Compound Name | sodium (2R,3R)-2-amino-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbutanoate |
|---|---|
| PubChem CID | 23697835 |
| Molecular Formula | C11H24NNaO3Si |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | sodium (2R,3R)-2-amino-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbutanoate |
| SMILES | C[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H](N)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C11H25NO3Si.Na/c1-8(9(12)10(13)14)7-15-16(5,6)11(2,3)4;/h8-9H,7,12H2,1-6H3,(H,13,14);/q;+1/p-1/t8-,9+;/m0./s1 |
| InChIKey | JFIMGMLQOUEPAM-OULXEKPRSA-M |
| XLogP | -2.27 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|