C9H23NO2Si — CID 101238862
(2S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxypropan-1-ol (PubChem CID 101238862) has the molecular formula C9H23NO2Si and a molecular weight of 205.37 g/mol. Its IUPAC name is (2S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxypropan-1-ol.
| Compound Name | (2S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxypropan-1-ol |
|---|---|
| PubChem CID | 101238862 |
| Molecular Formula | C9H23NO2Si |
| Molecular Weight | 205.37 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (2S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxypropan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](N)CO |
| InChI | InChI=1S/C9H23NO2Si/c1-9(2,3)13(4,5)12-7-8(10)6-11/h8,11H,6-7,10H2,1-5H3/t8-/m0/s1 |
| InChIKey | LPLDCSWTBSTLOX-QMMMGPOBSA-N |
| XLogP | 1.33 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|