C12H25F3O3Si — CID 11833579
(2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(trifluoromethyl)pentane-1,4-diol (PubChem CID 11833579) has the molecular formula C12H25F3O3Si and a molecular weight of 302.41 g/mol. Its IUPAC name is (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(trifluoromethyl)pentane-1,4-diol.
| Compound Name | (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(trifluoromethyl)pentane-1,4-diol |
|---|---|
| PubChem CID | 11833579 |
| Molecular Formula | C12H25F3O3Si |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(trifluoromethyl)pentane-1,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](O)C[C@H](CO)C(F)(F)F |
| InChI | InChI=1S/C12H25F3O3Si/c1-11(2,3)19(4,5)18-8-10(17)6-9(7-16)12(13,14)15/h9-10,16-17H,6-8H2,1-5H3/t9-,10+/m1/s1 |
| InChIKey | LYRJPHQSYCJJAI-ZJUUUORDSA-N |
| XLogP | 2.93 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|