C17H38O3Si — CID 10710726
(2R,4S,5S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,4-dimethyloctane-1,5-diol (PubChem CID 10710726) has the molecular formula C17H38O3Si and a molecular weight of 318.57 g/mol. Its IUPAC name is (2R,4S,5S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,4-dimethyloctane-1,5-diol.
| Compound Name | (2R,4S,5S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,4-dimethyloctane-1,5-diol |
|---|---|
| PubChem CID | 10710726 |
| Molecular Formula | C17H38O3Si |
| Molecular Weight | 318.57 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (2R,4S,5S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,4-dimethyloctane-1,5-diol |
| SMILES | CC[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](C)C[C@@H](C)CO |
| InChI | InChI=1S/C17H38O3Si/c1-9-15(12-20-21(7,8)17(4,5)6)16(19)14(3)10-13(2)11-18/h13-16,18-19H,9-12H2,1-8H3/t13-,14+,15+,16+/m1/s1 |
| InChIKey | ABQZPGJRDFAQDD-UGUYLWEFSA-N |
| XLogP | 4.05 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.57 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|