C19H42O3Si — CID 54768092
(2S,3R,4S,6S,8R)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethylnonane-1,3-diol (PubChem CID 54768092) has the molecular formula C19H42O3Si and a molecular weight of 346.63 g/mol. Its IUPAC name is (2S,3R,4S,6S,8R)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethylnonane-1,3-diol.
| Compound Name | (2S,3R,4S,6S,8R)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethylnonane-1,3-diol |
|---|---|
| PubChem CID | 54768092 |
| Molecular Formula | C19H42O3Si |
| Molecular Weight | 346.63 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | (2S,3R,4S,6S,8R)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethylnonane-1,3-diol |
| SMILES | C[C@@H](CO[Si](C)(C)C(C)(C)C)C[C@H](C)C[C@H](C)[C@@H](O)[C@@H](C)CO |
| InChI | InChI=1S/C19H42O3Si/c1-14(11-16(3)18(21)17(4)12-20)10-15(2)13-22-23(8,9)19(5,6)7/h14-18,20-21H,10-13H2,1-9H3/t14-,15+,16-,17-,18+/m0/s1 |
| InChIKey | FTBPUVABFLZBGS-FLXSYLCISA-N |
| XLogP | 4.69 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|