C19H27NO2Si — CID 129407863
(2R)-2-amino-3-[tert-butyl(diphenyl)silyl]oxypropan-1-ol (PubChem CID 129407863) has the molecular formula C19H27NO2Si and a molecular weight of 329.52 g/mol. Its IUPAC name is (2R)-2-amino-3-[tert-butyl(diphenyl)silyl]oxypropan-1-ol.
| Compound Name | (2R)-2-amino-3-[tert-butyl(diphenyl)silyl]oxypropan-1-ol |
|---|---|
| PubChem CID | 129407863 |
| Molecular Formula | C19H27NO2Si |
| Molecular Weight | 329.52 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | (2R)-2-amino-3-[tert-butyl(diphenyl)silyl]oxypropan-1-ol |
| SMILES | CC(C)(C)[Si](OC[C@H](N)CO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H27NO2Si/c1-19(2,3)23(22-15-16(20)14-21,17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,16,21H,14-15,20H2,1-3H3/t16-/m1/s1 |
| InChIKey | FHULOYPIFMKIHG-MRXNPFEDSA-N |
| XLogP | 1.88 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.52 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|