C25H31NO2Si — CID 72711968
4-[(2S)-2-amino-3-[tert-butyl(diphenyl)silyl]oxypropyl]phenol (PubChem CID 72711968) has the molecular formula C25H31NO2Si and a molecular weight of 405.61 g/mol. Its IUPAC name is 4-[(2S)-2-amino-3-[tert-butyl(diphenyl)silyl]oxypropyl]phenol.
| Compound Name | 4-[(2S)-2-amino-3-[tert-butyl(diphenyl)silyl]oxypropyl]phenol |
|---|---|
| PubChem CID | 72711968 |
| Molecular Formula | C25H31NO2Si |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 4-[(2S)-2-amino-3-[tert-butyl(diphenyl)silyl]oxypropyl]phenol |
| SMILES | CC(C)(C)[Si](OC[C@@H](N)Cc1ccc(O)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H31NO2Si/c1-25(2,3)29(23-10-6-4-7-11-23,24-12-8-5-9-13-24)28-19-21(26)18-20-14-16-22(27)17-15-20/h4-17,21,27H,18-19,26H2,1-3H3/t21-/m0/s1 |
| InChIKey | SKJOHTVHIVVTOI-NRFANRHFSA-N |
| XLogP | 3.84 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|