C26H30O2Si — CID 72713425
4-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]prop-2-enyl]phenol (PubChem CID 72713425) has the molecular formula C26H30O2Si and a molecular weight of 402.61 g/mol. Its IUPAC name is 4-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]prop-2-enyl]phenol.
| Compound Name | 4-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]prop-2-enyl]phenol |
|---|---|
| PubChem CID | 72713425 |
| Molecular Formula | C26H30O2Si |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 4-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]prop-2-enyl]phenol |
| SMILES | C=C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C26H30O2Si/c1-21(19-22-15-17-23(27)18-16-22)20-28-29(26(2,3)4,24-11-7-5-8-12-24)25-13-9-6-10-14-25/h5-18,27H,1,19-20H2,2-4H3 |
| InChIKey | KNBNKCRQSUHPTA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|