C24H28O3Si — CID 11269381
5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxyphenol (PubChem CID 11269381) has the molecular formula C24H28O3Si and a molecular weight of 392.57 g/mol. Its IUPAC name is 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxyphenol.
| Compound Name | 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 11269381 |
| Molecular Formula | C24H28O3Si |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxyphenol |
| SMILES | COc1ccc(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1O |
| InChI | InChI=1S/C24H28O3Si/c1-24(2,3)28(20-11-7-5-8-12-20,21-13-9-6-10-14-21)27-18-19-15-16-23(26-4)22(25)17-19/h5-17,25H,18H2,1-4H3 |
| InChIKey | UHYXDBKWUDGAQY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|