C16H16O5 — CID 123382824
3-deuterio-2-hydroxy-3-(3-hydroxy-4-methoxyphenyl)-2-phenylpropanoic acid (PubChem CID 123382824) has the molecular formula C16H16O5 and a molecular weight of 289.31 g/mol. Its IUPAC name is 3-deuterio-2-hydroxy-3-(3-hydroxy-4-methoxyphenyl)-2-phenylpropanoic acid.
| Compound Name | 3-deuterio-2-hydroxy-3-(3-hydroxy-4-methoxyphenyl)-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 123382824 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 3-deuterio-2-hydroxy-3-(3-hydroxy-4-methoxyphenyl)-2-phenylpropanoic acid |
| SMILES | [2H]C(c1ccc(OC)c(O)c1)C(O)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H16O5/c1-21-14-8-7-11(9-13(14)17)10-16(20,15(18)19)12-5-3-2-4-6-12/h2-9,17,20H,10H2,1H3,(H,18,19)/i10D |
| InChIKey | UIIKXCPQSXTPLW-MMIHMFRQSA-N |
| XLogP | 1.92 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |