C21H24O6 — CID 22501459
1,7-bis(3-hydroxy-4-methoxyphenyl)heptane-3,5-dione (PubChem CID 22501459) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is 1,7-bis(3-hydroxy-4-methoxyphenyl)heptane-3,5-dione.
| Compound Name | 1,7-bis(3-hydroxy-4-methoxyphenyl)heptane-3,5-dione |
|---|---|
| PubChem CID | 22501459 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1,7-bis(3-hydroxy-4-methoxyphenyl)heptane-3,5-dione |
| SMILES | COc1ccc(CCC(=O)CC(=O)CCc2ccc(OC)c(O)c2)cc1O |
| InChI | InChI=1S/C21H24O6/c1-26-20-9-5-14(11-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-21(27-2)19(25)12-15/h5-6,9-12,24-25H,3-4,7-8,13H2,1-2H3 |
| InChIKey | VNJGALUDGGYKJR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|