C19H20O4 — CID 24788998
6-(4-hydroxy-3-methoxyphenyl)-1-phenylhexane-2,4-dione (PubChem CID 24788998) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is 6-(4-hydroxy-3-methoxyphenyl)-1-phenylhexane-2,4-dione.
| Compound Name | 6-(4-hydroxy-3-methoxyphenyl)-1-phenylhexane-2,4-dione |
|---|---|
| PubChem CID | 24788998 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 6-(4-hydroxy-3-methoxyphenyl)-1-phenylhexane-2,4-dione |
| SMILES | COc1cc(CCC(=O)CC(=O)Cc2ccccc2)ccc1O |
| InChI | InChI=1S/C19H20O4/c1-23-19-12-15(8-10-18(19)22)7-9-16(20)13-17(21)11-14-5-3-2-4-6-14/h2-6,8,10,12,22H,7,9,11,13H2,1H3 |
| InChIKey | ADKSUZXPMYEAON-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|