C31H36O6 — CID 163099034
(9R)-1-(4-hydroxy-3-methoxyphenyl)-11-(3-hydroxyphenyl)-9-[(3-hydroxyphenyl)methyl]undecane-3,5-dione (PubChem CID 163099034) has the molecular formula C31H36O6 and a molecular weight of 504.62 g/mol. Its IUPAC name is (9R)-1-(4-hydroxy-3-methoxyphenyl)-11-(3-hydroxyphenyl)-9-[(3-hydroxyphenyl)methyl]undecane-3,5-dione.
| Compound Name | (9R)-1-(4-hydroxy-3-methoxyphenyl)-11-(3-hydroxyphenyl)-9-[(3-hydroxyphenyl)methyl]undecane-3,5-dione |
|---|---|
| PubChem CID | 163099034 |
| Molecular Formula | C31H36O6 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | (9R)-1-(4-hydroxy-3-methoxyphenyl)-11-(3-hydroxyphenyl)-9-[(3-hydroxyphenyl)methyl]undecane-3,5-dione |
| SMILES | COc1cc(CCC(=O)CC(=O)CCC[C@H](CCc2cccc(O)c2)Cc2cccc(O)c2)ccc1O |
| InChI | InChI=1S/C31H36O6/c1-37-31-20-24(14-16-30(31)36)13-15-29(35)21-28(34)10-2-5-22(17-25-7-4-9-27(33)19-25)11-12-23-6-3-8-26(32)18-23/h3-4,6-9,14,16,18-20,22,32-33,36H,2,5,10-13,15,17,21H2,1H3/t22-/m1/s1 |
| InChIKey | OUSYVPYGJVGWBZ-JOCHJYFZSA-N |
| XLogP | 5.93 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|