C24H37N3O4 — CID 162833650
2-cyclohexyl-1-[10-(4-hydroxy-3-methoxyphenyl)-6,8-dioxodecan-2-yl]guanidine (PubChem CID 162833650) has the molecular formula C24H37N3O4 and a molecular weight of 431.58 g/mol. Its IUPAC name is 2-cyclohexyl-1-[10-(4-hydroxy-3-methoxyphenyl)-6,8-dioxodecan-2-yl]guanidine.
| Compound Name | 2-cyclohexyl-1-[10-(4-hydroxy-3-methoxyphenyl)-6,8-dioxodecan-2-yl]guanidine |
|---|---|
| PubChem CID | 162833650 |
| Molecular Formula | C24H37N3O4 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | 2-cyclohexyl-1-[10-(4-hydroxy-3-methoxyphenyl)-6,8-dioxodecan-2-yl]guanidine |
| SMILES | COc1cc(CCC(=O)CC(=O)CCCC(C)N/C(N)=N/C2CCCCC2)ccc1O |
| InChI | InChI=1S/C24H37N3O4/c1-17(26-24(25)27-19-8-4-3-5-9-19)7-6-10-20(28)16-21(29)13-11-18-12-14-22(30)23(15-18)31-2/h12,14-15,17,19,30H,3-11,13,16H2,1-2H3,(H3,25,26,27) |
| InChIKey | XAYZQSAOHULPHK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|