C27H39N5O4 — CID 163100878
1-[(3R)-11-(3-cyclopentyloxy-4-hydroxyphenyl)-1-imidazol-1-yl-7,9-dioxoundecan-3-yl]-2-methylguanidine (PubChem CID 163100878) has the molecular formula C27H39N5O4 and a molecular weight of 497.64 g/mol. Its IUPAC name is 1-[(3R)-11-(3-cyclopentyloxy-4-hydroxyphenyl)-1-imidazol-1-yl-7,9-dioxoundecan-3-yl]-2-methylguanidine.
| Compound Name | 1-[(3R)-11-(3-cyclopentyloxy-4-hydroxyphenyl)-1-imidazol-1-yl-7,9-dioxoundecan-3-yl]-2-methylguanidine |
|---|---|
| PubChem CID | 163100878 |
| Molecular Formula | C27H39N5O4 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | 1-[(3R)-11-(3-cyclopentyloxy-4-hydroxyphenyl)-1-imidazol-1-yl-7,9-dioxoundecan-3-yl]-2-methylguanidine |
| SMILES | C/N=C(\N)N[C@H](CCCC(=O)CC(=O)CCc1ccc(O)c(OC2CCCC2)c1)CCn1ccnc1 |
| InChI | InChI=1S/C27H39N5O4/c1-29-27(28)31-21(13-15-32-16-14-30-19-32)5-4-6-22(33)18-23(34)11-9-20-10-12-25(35)26(17-20)36-24-7-2-3-8-24/h10,12,14,16-17,19,21,24,35H,2-9,11,13,15,18H2,1H3,(H3,28,29,31)/t21-/m1/s1 |
| InChIKey | MWRDFMTVJLQAAL-OAQYLSRUSA-N |
| XLogP | 3.53 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|