C29H43N5O4 — CID 163174660
1-(3-cyclopentyloxy-4-hydroxyphenyl)-8-[6-(1,2-dihydroimidazol-3-yl)-2-methylimino-1,3-diazocan-4-yl]octane-3,5-dione (PubChem CID 163174660) has the molecular formula C29H43N5O4 and a molecular weight of 525.69 g/mol. Its IUPAC name is 1-(3-cyclopentyloxy-4-hydroxyphenyl)-8-[6-(1,2-dihydroimidazol-3-yl)-2-methylimino-1,3-diazocan-4-yl]octane-3,5-dione.
| Compound Name | 1-(3-cyclopentyloxy-4-hydroxyphenyl)-8-[6-(1,2-dihydroimidazol-3-yl)-2-methylimino-1,3-diazocan-4-yl]octane-3,5-dione |
|---|---|
| PubChem CID | 163174660 |
| Molecular Formula | C29H43N5O4 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.33 |
| IUPAC Name | 1-(3-cyclopentyloxy-4-hydroxyphenyl)-8-[6-(1,2-dihydroimidazol-3-yl)-2-methylimino-1,3-diazocan-4-yl]octane-3,5-dione |
| SMILES | C/N=C1\NCCC(N2C=CNC2)CC(CCCC(=O)CC(=O)CCc2ccc(O)c(OC3CCCC3)c2)N1 |
| InChI | InChI=1S/C29H43N5O4/c1-30-29-32-14-13-23(34-16-15-31-20-34)18-22(33-29)5-4-6-24(35)19-25(36)11-9-21-10-12-27(37)28(17-21)38-26-7-2-3-8-26/h10,12,15-17,22-23,26,31,37H,2-9,11,13-14,18-20H2,1H3,(H2,30,32,33) |
| InChIKey | WTSGTGPVYJCVCM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|