C38H42O6 — CID 162826258
1-(3-cyclopentyloxy-4-hydroxyphenyl)-11-[3-hydroxy-2-(6-hydroxynaphthalen-2-yl)phenyl]undecane-3,5-dione (PubChem CID 162826258) has the molecular formula C38H42O6 and a molecular weight of 594.75 g/mol. Its IUPAC name is 1-(3-cyclopentyloxy-4-hydroxyphenyl)-11-[3-hydroxy-2-(6-hydroxynaphthalen-2-yl)phenyl]undecane-3,5-dione.
| Compound Name | 1-(3-cyclopentyloxy-4-hydroxyphenyl)-11-[3-hydroxy-2-(6-hydroxynaphthalen-2-yl)phenyl]undecane-3,5-dione |
|---|---|
| PubChem CID | 162826258 |
| Molecular Formula | C38H42O6 |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | 1-(3-cyclopentyloxy-4-hydroxyphenyl)-11-[3-hydroxy-2-(6-hydroxynaphthalen-2-yl)phenyl]undecane-3,5-dione |
| SMILES | O=C(CCCCCCc1cccc(O)c1-c1ccc2cc(O)ccc2c1)CC(=O)CCc1ccc(O)c(OC2CCCC2)c1 |
| InChI | InChI=1S/C38H42O6/c39-31(25-33(41)19-14-26-15-21-35(42)37(22-26)44-34-11-5-6-12-34)10-4-2-1-3-8-27-9-7-13-36(43)38(27)30-17-16-29-24-32(40)20-18-28(29)23-30/h7,9,13,15-18,20-24,34,40,42-43H,1-6,8,10-12,14,19,25H2 |
| InChIKey | LPOXPBUDCBQPKQ-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|