C34H38NO5- — CID 162801910
5-(3-cyclopentyloxy-4-hydroxyphenyl)-1-[4-[4-(3-hydroxyphenyl)butyl]-4,5-dihydroindol-1-id-5-yl]pentane-1,3-dione (PubChem CID 162801910) has the molecular formula C34H38NO5- and a molecular weight of 540.68 g/mol. Its IUPAC name is 5-(3-cyclopentyloxy-4-hydroxyphenyl)-1-[4-[4-(3-hydroxyphenyl)butyl]-4,5-dihydroindol-1-id-5-yl]pentane-1,3-dione.
| Compound Name | 5-(3-cyclopentyloxy-4-hydroxyphenyl)-1-[4-[4-(3-hydroxyphenyl)butyl]-4,5-dihydroindol-1-id-5-yl]pentane-1,3-dione |
|---|---|
| PubChem CID | 162801910 |
| Molecular Formula | C34H38NO5- |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | 5-(3-cyclopentyloxy-4-hydroxyphenyl)-1-[4-[4-(3-hydroxyphenyl)butyl]-4,5-dihydroindol-1-id-5-yl]pentane-1,3-dione |
| SMILES | O=C(CCc1ccc(O)c(OC2CCCC2)c1)CC(=O)C1C=Cc2[n-]ccc2C1CCCCc1cccc(O)c1 |
| InChI | InChI=1S/C34H38NO5/c36-25-8-5-7-23(20-25)6-1-4-11-28-29-18-19-35-31(29)16-15-30(28)33(39)22-26(37)14-12-24-13-17-32(38)34(21-24)40-27-9-2-3-10-27/h5,7-8,13,15-21,27-28,30,36,38H,1-4,6,9-12,14,22H2/q-1 |
| InChIKey | JAFWRECIIHLXEQ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 97.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|