C41H48N4O5-2 — CID 162793618
[5-[5-[3-cyclopentyloxy-4-hydroxy-5-(methylaminomethyl)phenyl]-3-oxopentanoyl]-4-[4-(3-hydroxyphenyl)butyl]-4,5-dihydroindol-1-id-6-yl]methyl-(1H-pyrrol-2-yl)azanide (PubChem CID 162793618) has the molecular formula C41H48N4O5-2 and a molecular weight of 676.86 g/mol. Its IUPAC name is [5-[5-[3-cyclopentyloxy-4-hydroxy-5-(methylaminomethyl)phenyl]-3-oxopentanoyl]-4-[4-(3-hydroxyphenyl)butyl]-4,5-dihydroindol-1-id-6-yl]methyl-(1H-pyrrol-2-yl)azanide.
| Compound Name | [5-[5-[3-cyclopentyloxy-4-hydroxy-5-(methylaminomethyl)phenyl]-3-oxopentanoyl]-4-[4-(3-hydroxyphenyl)butyl]-4,5-dihydroindol-1-id-6-yl]methyl-(1H-pyrrol-2-yl)azanide |
|---|---|
| PubChem CID | 162793618 |
| Molecular Formula | C41H48N4O5-2 |
| Molecular Weight | 676.86 g/mol |
| Exact Mass | 676.36 |
| IUPAC Name | [5-[5-[3-cyclopentyloxy-4-hydroxy-5-(methylaminomethyl)phenyl]-3-oxopentanoyl]-4-[4-(3-hydroxyphenyl)butyl]-4,5-dihydroindol-1-id-6-yl]methyl-(1H-pyrrol-2-yl)azanide |
| SMILES | CNCc1cc(CCC(=O)CC(=O)C2C(C[N-]c3ccc[nH]3)=Cc3[n-]ccc3C2CCCCc2cccc(O)c2)cc(OC2CCCC2)c1O |
| InChI | InChI=1S/C41H48N4O5/c1-42-25-30-20-28(22-38(41(30)49)50-33-11-3-4-12-33)15-16-32(47)24-37(48)40-29(26-45-39-14-7-18-44-39)23-36-34(17-19-43-36)35(40)13-5-2-8-27-9-6-10-31(46)21-27/h6-7,9-10,14,17-23,33,35,40,42,44,46,49H,2-5,8,11-13,15-16,24-26H2,1H3/q-2 |
| InChIKey | NFBVDFIPPRHECQ-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 139.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.86 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|