C25H41NO5 — CID 162995410
[1-[3-cyclopentyloxy-4-hydroxy-5-(methylaminomethyl)phenyl]-5-hydroxydecan-3-yl] acetate (PubChem CID 162995410) has the molecular formula C25H41NO5 and a molecular weight of 435.61 g/mol. Its IUPAC name is [1-[3-cyclopentyloxy-4-hydroxy-5-(methylaminomethyl)phenyl]-5-hydroxydecan-3-yl] acetate.
| Compound Name | [1-[3-cyclopentyloxy-4-hydroxy-5-(methylaminomethyl)phenyl]-5-hydroxydecan-3-yl] acetate |
|---|---|
| PubChem CID | 162995410 |
| Molecular Formula | C25H41NO5 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | [1-[3-cyclopentyloxy-4-hydroxy-5-(methylaminomethyl)phenyl]-5-hydroxydecan-3-yl] acetate |
| SMILES | CCCCCC(O)CC(CCc1cc(CNC)c(O)c(OC2CCCC2)c1)OC(C)=O |
| InChI | InChI=1S/C25H41NO5/c1-4-5-6-9-21(28)16-23(30-18(2)27)13-12-19-14-20(17-26-3)25(29)24(15-19)31-22-10-7-8-11-22/h14-15,21-23,26,28-29H,4-13,16-17H2,1-3H3 |
| InChIKey | FPJQBMWNNHVTJY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|